C34H46N6O11S — CID 170169094
[4-[2-[[1-[4-[4-[2-(2-azidooxyethoxy)ethoxy]butoxy]phenyl]sulfonylpyrrolidine-2-carbonyl]amino]-3-methoxy-3-oxopropyl]phenyl] pyrrolidine-1-carboxylate (PubChem CID 170169094) has the molecular formula C34H46N6O11S and a molecular weight of 746.84 g/mol. Its IUPAC name is [4-[2-[[1-[4-[4-[2-(2-azidooxyethoxy)ethoxy]butoxy]phenyl]sulfonylpyrrolidine-2-carbonyl]amino]-3-methoxy-3-oxopropyl]phenyl] pyrrolidine-1-carboxylate.
| Compound Name | [4-[2-[[1-[4-[4-[2-(2-azidooxyethoxy)ethoxy]butoxy]phenyl]sulfonylpyrrolidine-2-carbonyl]amino]-3-methoxy-3-oxopropyl]phenyl] pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 170169094 |
| Molecular Formula | C34H46N6O11S |
| Molecular Weight | 746.84 g/mol |
| Exact Mass | 746.29 |
| IUPAC Name | [4-[2-[[1-[4-[4-[2-(2-azidooxyethoxy)ethoxy]butoxy]phenyl]sulfonylpyrrolidine-2-carbonyl]amino]-3-methoxy-3-oxopropyl]phenyl] pyrrolidine-1-carboxylate |
| SMILES | COC(=O)C(Cc1ccc(OC(=O)N2CCCC2)cc1)NC(=O)C1CCCN1S(=O)(=O)c1ccc(OCCCCOCCOCCON=[N+]=[N-])cc1 |
| InChI | InChI=1S/C34H46N6O11S/c1-46-33(42)30(25-26-8-10-28(11-9-26)51-34(43)39-16-2-3-17-39)36-32(41)31-7-6-18-40(31)52(44,45)29-14-12-27(13-15-29)49-20-5-4-19-47-21-22-48-23-24-50-38-37-35/h8-15,30-31H,2-7,16-25H2,1H3,(H,36,41) |
| InChIKey | DXMDIZKYJZNFBO-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 208.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 746.84 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|