C23H21N3O7S — CID 69377021
methyl (2S)-2-[[2-(benzenesulfonyl)phenyl]carbamoylamino]-3-(4-nitrophenyl)propanoate (PubChem CID 69377021) has the molecular formula C23H21N3O7S and a molecular weight of 483.50 g/mol. Its IUPAC name is methyl (2S)-2-[[2-(benzenesulfonyl)phenyl]carbamoylamino]-3-(4-nitrophenyl)propanoate.
| Compound Name | methyl (2S)-2-[[2-(benzenesulfonyl)phenyl]carbamoylamino]-3-(4-nitrophenyl)propanoate |
|---|---|
| PubChem CID | 69377021 |
| Molecular Formula | C23H21N3O7S |
| Molecular Weight | 483.50 g/mol |
| Exact Mass | 483.11 |
| IUPAC Name | methyl (2S)-2-[[2-(benzenesulfonyl)phenyl]carbamoylamino]-3-(4-nitrophenyl)propanoate |
| SMILES | COC(=O)[C@H](Cc1ccc([N+](=O)[O-])cc1)NC(=O)Nc1ccccc1S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C23H21N3O7S/c1-33-22(27)20(15-16-11-13-17(14-12-16)26(29)30)25-23(28)24-19-9-5-6-10-21(19)34(31,32)18-7-3-2-4-8-18/h2-14,20H,15H2,1H3,(H2,24,25,28)/t20-/m0/s1 |
| InChIKey | GGTWWRLEQLYTGN-FQEVSTJZSA-N |
| XLogP | 3.33 |
| TPSA | 144.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.50 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|