C12H10Cl3NO — CID 71357884
3,4,5-trichloro-N-(2-methylbut-3-yn-2-yl)benzamide (PubChem CID 71357884) has the molecular formula C12H10Cl3NO and a molecular weight of 290.58 g/mol. Its IUPAC name is 3,4,5-trichloro-N-(2-methylbut-3-yn-2-yl)benzamide.
| Compound Name | 3,4,5-trichloro-N-(2-methylbut-3-yn-2-yl)benzamide |
|---|---|
| PubChem CID | 71357884 |
| Molecular Formula | C12H10Cl3NO |
| Molecular Weight | 290.58 g/mol |
| Exact Mass | 288.98 |
| IUPAC Name | 3,4,5-trichloro-N-(2-methylbut-3-yn-2-yl)benzamide |
| SMILES | C#CC(C)(C)NC(=O)c1cc(Cl)c(Cl)c(Cl)c1 |
| InChI | InChI=1S/C12H10Cl3NO/c1-4-12(2,3)16-11(17)7-5-8(13)10(15)9(14)6-7/h1,5-6H,2-3H3,(H,16,17) |
| InChIKey | HYAWLRKNZANOJY-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.58 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|