C9H9BrN2OS — CID 170741009
2-bromo-N-(2-methylbut-3-yn-2-yl)-1,3-thiazole-4-carboxamide (PubChem CID 170741009) has the molecular formula C9H9BrN2OS and a molecular weight of 273.16 g/mol. Its IUPAC name is 2-bromo-N-(2-methylbut-3-yn-2-yl)-1,3-thiazole-4-carboxamide.
| Compound Name | 2-bromo-N-(2-methylbut-3-yn-2-yl)-1,3-thiazole-4-carboxamide |
|---|---|
| PubChem CID | 170741009 |
| Molecular Formula | C9H9BrN2OS |
| Molecular Weight | 273.16 g/mol |
| Exact Mass | 271.96 |
| IUPAC Name | 2-bromo-N-(2-methylbut-3-yn-2-yl)-1,3-thiazole-4-carboxamide |
| SMILES | C#CC(C)(C)NC(=O)c1csc(Br)n1 |
| InChI | InChI=1S/C9H9BrN2OS/c1-4-9(2,3)12-7(13)6-5-14-8(10)11-6/h1,5H,2-3H3,(H,12,13) |
| InChIKey | PMJZTLOSOJADEC-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.16 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|