C11H14Cl2N2O3S — CID 113339035
N-(2-but-3-enoxyethyl)-5,6-dichloropyridine-3-sulfonamide (PubChem CID 113339035) has the molecular formula C11H14Cl2N2O3S and a molecular weight of 325.22 g/mol. Its IUPAC name is N-(2-but-3-enoxyethyl)-5,6-dichloropyridine-3-sulfonamide.
| Compound Name | N-(2-but-3-enoxyethyl)-5,6-dichloropyridine-3-sulfonamide |
|---|---|
| PubChem CID | 113339035 |
| Molecular Formula | C11H14Cl2N2O3S |
| Molecular Weight | 325.22 g/mol |
| Exact Mass | 324.01 |
| IUPAC Name | N-(2-but-3-enoxyethyl)-5,6-dichloropyridine-3-sulfonamide |
| SMILES | C=CCCOCCNS(=O)(=O)c1cnc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C11H14Cl2N2O3S/c1-2-3-5-18-6-4-15-19(16,17)9-7-10(12)11(13)14-8-9/h2,7-8,15H,1,3-6H2 |
| InChIKey | LZDLKYBLMSMCKM-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 68.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.22 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|