C12H18N2O5S2 — CID 103854020
4-N-(2-but-3-enoxyethyl)benzene-1,4-disulfonamide (PubChem CID 103854020) has the molecular formula C12H18N2O5S2 and a molecular weight of 334.42 g/mol. Its IUPAC name is 4-N-(2-but-3-enoxyethyl)benzene-1,4-disulfonamide.
| Compound Name | 4-N-(2-but-3-enoxyethyl)benzene-1,4-disulfonamide |
|---|---|
| PubChem CID | 103854020 |
| Molecular Formula | C12H18N2O5S2 |
| Molecular Weight | 334.42 g/mol |
| Exact Mass | 334.07 |
| IUPAC Name | 4-N-(2-but-3-enoxyethyl)benzene-1,4-disulfonamide |
| SMILES | C=CCCOCCNS(=O)(=O)c1ccc(S(N)(=O)=O)cc1 |
| InChI | InChI=1S/C12H18N2O5S2/c1-2-3-9-19-10-8-14-21(17,18)12-6-4-11(5-7-12)20(13,15)16/h2,4-7,14H,1,3,8-10H2,(H2,13,15,16) |
| InChIKey | FNUVWKMGNAANLW-UHFFFAOYSA-N |
| XLogP | 0.20 |
| TPSA | 115.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.42 |
| LogP ≤ 5 | 0.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|