C13H25N5O2S — CID 106051046
1-(3-aminopropyl)-N-[(1-methylpiperidin-2-yl)methyl]pyrazole-4-sulfonamide (PubChem CID 106051046) has the molecular formula C13H25N5O2S and a molecular weight of 315.44 g/mol. Its IUPAC name is 1-(3-aminopropyl)-N-[(1-methylpiperidin-2-yl)methyl]pyrazole-4-sulfonamide.
| Compound Name | 1-(3-aminopropyl)-N-[(1-methylpiperidin-2-yl)methyl]pyrazole-4-sulfonamide |
|---|---|
| PubChem CID | 106051046 |
| Molecular Formula | C13H25N5O2S |
| Molecular Weight | 315.44 g/mol |
| Exact Mass | 315.17 |
| IUPAC Name | 1-(3-aminopropyl)-N-[(1-methylpiperidin-2-yl)methyl]pyrazole-4-sulfonamide |
| SMILES | CN1CCCCC1CNS(=O)(=O)c1cnn(CCCN)c1 |
| InChI | InChI=1S/C13H25N5O2S/c1-17-7-3-2-5-12(17)9-16-21(19,20)13-10-15-18(11-13)8-4-6-14/h10-12,16H,2-9,14H2,1H3 |
| InChIKey | UBLAEDRBTSULGX-UHFFFAOYSA-N |
| XLogP | -0.01 |
| TPSA | 93.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.44 |
| LogP ≤ 5 | -0.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |