C12H20N4O4S — CID 106019277
3-[4-[(1-methylpyrrolidin-2-yl)methylsulfamoyl]pyrazol-1-yl]propanoic acid (PubChem CID 106019277) has the molecular formula C12H20N4O4S and a molecular weight of 316.38 g/mol. Its IUPAC name is 3-[4-[(1-methylpyrrolidin-2-yl)methylsulfamoyl]pyrazol-1-yl]propanoic acid.
| Compound Name | 3-[4-[(1-methylpyrrolidin-2-yl)methylsulfamoyl]pyrazol-1-yl]propanoic acid |
|---|---|
| PubChem CID | 106019277 |
| Molecular Formula | C12H20N4O4S |
| Molecular Weight | 316.38 g/mol |
| Exact Mass | 316.12 |
| IUPAC Name | 3-[4-[(1-methylpyrrolidin-2-yl)methylsulfamoyl]pyrazol-1-yl]propanoic acid |
| SMILES | CN1CCCC1CNS(=O)(=O)c1cnn(CCC(=O)O)c1 |
| InChI | InChI=1S/C12H20N4O4S/c1-15-5-2-3-10(15)7-14-21(19,20)11-8-13-16(9-11)6-4-12(17)18/h8-10,14H,2-7H2,1H3,(H,17,18) |
| InChIKey | RRRZYRRZPBAQAL-UHFFFAOYSA-N |
| XLogP | -0.27 |
| TPSA | 104.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.38 |
| LogP ≤ 5 | -0.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |