C12H19N3O5S — CID 107216274
3-[4-[[(1R,2R)-2-hydroxycyclohexyl]sulfamoyl]pyrazol-1-yl]propanoic acid (PubChem CID 107216274) has the molecular formula C12H19N3O5S and a molecular weight of 317.37 g/mol. Its IUPAC name is 3-[4-[[(1R,2R)-2-hydroxycyclohexyl]sulfamoyl]pyrazol-1-yl]propanoic acid.
| Compound Name | 3-[4-[[(1R,2R)-2-hydroxycyclohexyl]sulfamoyl]pyrazol-1-yl]propanoic acid |
|---|---|
| PubChem CID | 107216274 |
| Molecular Formula | C12H19N3O5S |
| Molecular Weight | 317.37 g/mol |
| Exact Mass | 317.10 |
| IUPAC Name | 3-[4-[[(1R,2R)-2-hydroxycyclohexyl]sulfamoyl]pyrazol-1-yl]propanoic acid |
| SMILES | O=C(O)CCn1cc(S(=O)(=O)N[C@@H]2CCCC[C@H]2O)cn1 |
| InChI | InChI=1S/C12H19N3O5S/c16-11-4-2-1-3-10(11)14-21(19,20)9-7-13-15(8-9)6-5-12(17)18/h7-8,10-11,14,16H,1-6H2,(H,17,18)/t10-,11-/m1/s1 |
| InChIKey | RFXHKDZBFOMRLL-GHMZBOCLSA-N |
| XLogP | -0.06 |
| TPSA | 121.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.37 |
| LogP ≤ 5 | -0.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |