C14H21N3O4S — CID 139014302
2-[4-[(2-prop-2-enylcyclohexyl)sulfamoyl]pyrazol-1-yl]acetic acid (PubChem CID 139014302) has the molecular formula C14H21N3O4S and a molecular weight of 327.41 g/mol. Its IUPAC name is 2-[4-[(2-prop-2-enylcyclohexyl)sulfamoyl]pyrazol-1-yl]acetic acid.
| Compound Name | 2-[4-[(2-prop-2-enylcyclohexyl)sulfamoyl]pyrazol-1-yl]acetic acid |
|---|---|
| PubChem CID | 139014302 |
| Molecular Formula | C14H21N3O4S |
| Molecular Weight | 327.41 g/mol |
| Exact Mass | 327.13 |
| IUPAC Name | 2-[4-[(2-prop-2-enylcyclohexyl)sulfamoyl]pyrazol-1-yl]acetic acid |
| SMILES | C=CCC1CCCCC1NS(=O)(=O)c1cnn(CC(=O)O)c1 |
| InChI | InChI=1S/C14H21N3O4S/c1-2-5-11-6-3-4-7-13(11)16-22(20,21)12-8-15-17(9-12)10-14(18)19/h2,8-9,11,13,16H,1,3-7,10H2,(H,18,19) |
| InChIKey | HHHGMVGUPGYLRD-UHFFFAOYSA-N |
| XLogP | 1.38 |
| TPSA | 101.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.41 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|