C12H19N3O4S — CID 64909962
2-[4-[(2,3-dimethylcyclopentyl)sulfamoyl]pyrazol-1-yl]acetic acid (PubChem CID 64909962) has the molecular formula C12H19N3O4S and a molecular weight of 301.37 g/mol. Its IUPAC name is 2-[4-[(2,3-dimethylcyclopentyl)sulfamoyl]pyrazol-1-yl]acetic acid.
| Compound Name | 2-[4-[(2,3-dimethylcyclopentyl)sulfamoyl]pyrazol-1-yl]acetic acid |
|---|---|
| PubChem CID | 64909962 |
| Molecular Formula | C12H19N3O4S |
| Molecular Weight | 301.37 g/mol |
| Exact Mass | 301.11 |
| IUPAC Name | 2-[4-[(2,3-dimethylcyclopentyl)sulfamoyl]pyrazol-1-yl]acetic acid |
| SMILES | CC1CCC(NS(=O)(=O)c2cnn(CC(=O)O)c2)C1C |
| InChI | InChI=1S/C12H19N3O4S/c1-8-3-4-11(9(8)2)14-20(18,19)10-5-13-15(6-10)7-12(16)17/h5-6,8-9,11,14H,3-4,7H2,1-2H3,(H,16,17) |
| InChIKey | WXVDDKNFCZYYEV-UHFFFAOYSA-N |
| XLogP | 0.68 |
| TPSA | 101.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.37 |
| LogP ≤ 5 | 0.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |