C9H15N3O5S — CID 107216136
2-[4-[[(2R)-1-hydroxybutan-2-yl]sulfamoyl]pyrazol-1-yl]acetic acid (PubChem CID 107216136) has the molecular formula C9H15N3O5S and a molecular weight of 277.30 g/mol. Its IUPAC name is 2-[4-[[(2R)-1-hydroxybutan-2-yl]sulfamoyl]pyrazol-1-yl]acetic acid.
| Compound Name | 2-[4-[[(2R)-1-hydroxybutan-2-yl]sulfamoyl]pyrazol-1-yl]acetic acid |
|---|---|
| PubChem CID | 107216136 |
| Molecular Formula | C9H15N3O5S |
| Molecular Weight | 277.30 g/mol |
| Exact Mass | 277.07 |
| IUPAC Name | 2-[4-[[(2R)-1-hydroxybutan-2-yl]sulfamoyl]pyrazol-1-yl]acetic acid |
| SMILES | CC[C@H](CO)NS(=O)(=O)c1cnn(CC(=O)O)c1 |
| InChI | InChI=1S/C9H15N3O5S/c1-2-7(6-13)11-18(16,17)8-3-10-12(4-8)5-9(14)15/h3-4,7,11,13H,2,5-6H2,1H3,(H,14,15)/t7-/m1/s1 |
| InChIKey | CMQHJPJHCMHMHL-SSDOTTSWSA-N |
| XLogP | -0.98 |
| TPSA | 121.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.30 |
| LogP ≤ 5 | -0.98 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |