C10H16N4O5S — CID 43578551
2-[4-[[1-(ethylamino)-1-oxopropan-2-yl]sulfamoyl]pyrazol-1-yl]acetic acid (PubChem CID 43578551) has the molecular formula C10H16N4O5S and a molecular weight of 304.33 g/mol. Its IUPAC name is 2-[4-[[1-(ethylamino)-1-oxopropan-2-yl]sulfamoyl]pyrazol-1-yl]acetic acid.
| Compound Name | 2-[4-[[1-(ethylamino)-1-oxopropan-2-yl]sulfamoyl]pyrazol-1-yl]acetic acid |
|---|---|
| PubChem CID | 43578551 |
| Molecular Formula | C10H16N4O5S |
| Molecular Weight | 304.33 g/mol |
| Exact Mass | 304.08 |
| IUPAC Name | 2-[4-[[1-(ethylamino)-1-oxopropan-2-yl]sulfamoyl]pyrazol-1-yl]acetic acid |
| SMILES | CCNC(=O)C(C)NS(=O)(=O)c1cnn(CC(=O)O)c1 |
| InChI | InChI=1S/C10H16N4O5S/c1-3-11-10(17)7(2)13-20(18,19)8-4-12-14(5-8)6-9(15)16/h4-5,7,13H,3,6H2,1-2H3,(H,11,17)(H,15,16) |
| InChIKey | BNFAOLUSCGWFLE-UHFFFAOYSA-N |
| XLogP | -1.23 |
| TPSA | 130.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.33 |
| LogP ≤ 5 | -1.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |