C6H9N3O5S — CID 64973990
2-[4-(methoxysulfamoyl)pyrazol-1-yl]acetic acid (PubChem CID 64973990) has the molecular formula C6H9N3O5S and a molecular weight of 235.22 g/mol. Its IUPAC name is 2-[4-(methoxysulfamoyl)pyrazol-1-yl]acetic acid.
| Compound Name | 2-[4-(methoxysulfamoyl)pyrazol-1-yl]acetic acid |
|---|---|
| PubChem CID | 64973990 |
| Molecular Formula | C6H9N3O5S |
| Molecular Weight | 235.22 g/mol |
| Exact Mass | 235.03 |
| IUPAC Name | 2-[4-(methoxysulfamoyl)pyrazol-1-yl]acetic acid |
| SMILES | CONS(=O)(=O)c1cnn(CC(=O)O)c1 |
| InChI | InChI=1S/C6H9N3O5S/c1-14-8-15(12,13)5-2-7-9(3-5)4-6(10)11/h2-3,8H,4H2,1H3,(H,10,11) |
| InChIKey | RAXGCJQQYDOYQZ-UHFFFAOYSA-N |
| XLogP | -1.19 |
| TPSA | 110.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.22 |
| LogP ≤ 5 | -1.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|