C11H19N3O5S — CID 62518576
2-[4-[3-(hydroxymethyl)pentan-3-ylsulfamoyl]pyrazol-1-yl]acetic acid (PubChem CID 62518576) has the molecular formula C11H19N3O5S and a molecular weight of 305.36 g/mol. Its IUPAC name is 2-[4-[3-(hydroxymethyl)pentan-3-ylsulfamoyl]pyrazol-1-yl]acetic acid.
| Compound Name | 2-[4-[3-(hydroxymethyl)pentan-3-ylsulfamoyl]pyrazol-1-yl]acetic acid |
|---|---|
| PubChem CID | 62518576 |
| Molecular Formula | C11H19N3O5S |
| Molecular Weight | 305.36 g/mol |
| Exact Mass | 305.10 |
| IUPAC Name | 2-[4-[3-(hydroxymethyl)pentan-3-ylsulfamoyl]pyrazol-1-yl]acetic acid |
| SMILES | CCC(CC)(CO)NS(=O)(=O)c1cnn(CC(=O)O)c1 |
| InChI | InChI=1S/C11H19N3O5S/c1-3-11(4-2,8-15)13-20(18,19)9-5-12-14(6-9)7-10(16)17/h5-6,13,15H,3-4,7-8H2,1-2H3,(H,16,17) |
| InChIKey | NUFGXGJKLAADDO-UHFFFAOYSA-N |
| XLogP | -0.20 |
| TPSA | 121.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.36 |
| LogP ≤ 5 | -0.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |