C8H13N3O2S — CID 115628631
N-[(E)-pent-3-enyl]-1H-pyrazole-4-sulfonamide (PubChem CID 115628631) has the molecular formula C8H13N3O2S and a molecular weight of 215.28 g/mol. Its IUPAC name is N-[(E)-pent-3-enyl]-1H-pyrazole-4-sulfonamide.
| Compound Name | N-[(E)-pent-3-enyl]-1H-pyrazole-4-sulfonamide |
|---|---|
| PubChem CID | 115628631 |
| Molecular Formula | C8H13N3O2S |
| Molecular Weight | 215.28 g/mol |
| Exact Mass | 215.07 |
| IUPAC Name | N-[(E)-pent-3-enyl]-1H-pyrazole-4-sulfonamide |
| SMILES | C/C=C/CCNS(=O)(=O)c1cn[nH]c1 |
| InChI | InChI=1S/C8H13N3O2S/c1-2-3-4-5-11-14(12,13)8-6-9-10-7-8/h2-3,6-7,11H,4-5H2,1H3,(H,9,10)/b3-2+ |
| InChIKey | AMYMIJPYHOCVAN-NSCUHMNNSA-N |
| XLogP | 0.65 |
| TPSA | 74.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.28 |
| LogP ≤ 5 | 0.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|