C9H15N3O2S — CID 115897668
2-methyl-N-[(E)-pent-3-enyl]-1H-imidazole-5-sulfonamide (PubChem CID 115897668) has the molecular formula C9H15N3O2S and a molecular weight of 229.31 g/mol. Its IUPAC name is 2-methyl-N-[(E)-pent-3-enyl]-1H-imidazole-5-sulfonamide.
| Compound Name | 2-methyl-N-[(E)-pent-3-enyl]-1H-imidazole-5-sulfonamide |
|---|---|
| PubChem CID | 115897668 |
| Molecular Formula | C9H15N3O2S |
| Molecular Weight | 229.31 g/mol |
| Exact Mass | 229.09 |
| IUPAC Name | 2-methyl-N-[(E)-pent-3-enyl]-1H-imidazole-5-sulfonamide |
| SMILES | C/C=C/CCNS(=O)(=O)c1cnc(C)[nH]1 |
| InChI | InChI=1S/C9H15N3O2S/c1-3-4-5-6-11-15(13,14)9-7-10-8(2)12-9/h3-4,7,11H,5-6H2,1-2H3,(H,10,12)/b4-3+ |
| InChIKey | IVKQKYCOFTYTRB-ONEGZZNKSA-N |
| XLogP | 0.96 |
| TPSA | 74.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.31 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|