C10H20N4O3S — CID 103080924
N-[2-[2-(dimethylamino)ethoxy]ethyl]-2-methyl-1H-imidazole-5-sulfonamide (PubChem CID 103080924) has the molecular formula C10H20N4O3S and a molecular weight of 276.36 g/mol. Its IUPAC name is N-[2-[2-(dimethylamino)ethoxy]ethyl]-2-methyl-1H-imidazole-5-sulfonamide.
| Compound Name | N-[2-[2-(dimethylamino)ethoxy]ethyl]-2-methyl-1H-imidazole-5-sulfonamide |
|---|---|
| PubChem CID | 103080924 |
| Molecular Formula | C10H20N4O3S |
| Molecular Weight | 276.36 g/mol |
| Exact Mass | 276.13 |
| IUPAC Name | N-[2-[2-(dimethylamino)ethoxy]ethyl]-2-methyl-1H-imidazole-5-sulfonamide |
| SMILES | Cc1ncc(S(=O)(=O)NCCOCCN(C)C)[nH]1 |
| InChI | InChI=1S/C10H20N4O3S/c1-9-11-8-10(13-9)18(15,16)12-4-6-17-7-5-14(2)3/h8,12H,4-7H2,1-3H3,(H,11,13) |
| InChIKey | XXNSGTBWNWKXPY-UHFFFAOYSA-N |
| XLogP | -0.43 |
| TPSA | 87.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.36 |
| LogP ≤ 5 | -0.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|