C8H16N4O4S2 — CID 113349618
N-[3-(methanesulfonamido)propyl]-2-methyl-1H-imidazole-5-sulfonamide (PubChem CID 113349618) has the molecular formula C8H16N4O4S2 and a molecular weight of 296.37 g/mol. Its IUPAC name is N-[3-(methanesulfonamido)propyl]-2-methyl-1H-imidazole-5-sulfonamide.
| Compound Name | N-[3-(methanesulfonamido)propyl]-2-methyl-1H-imidazole-5-sulfonamide |
|---|---|
| PubChem CID | 113349618 |
| Molecular Formula | C8H16N4O4S2 |
| Molecular Weight | 296.37 g/mol |
| Exact Mass | 296.06 |
| IUPAC Name | N-[3-(methanesulfonamido)propyl]-2-methyl-1H-imidazole-5-sulfonamide |
| SMILES | Cc1ncc(S(=O)(=O)NCCCNS(C)(=O)=O)[nH]1 |
| InChI | InChI=1S/C8H16N4O4S2/c1-7-9-6-8(12-7)18(15,16)11-5-3-4-10-17(2,13)14/h6,10-11H,3-5H2,1-2H3,(H,9,12) |
| InChIKey | SUJWFKSEQRJESS-UHFFFAOYSA-N |
| XLogP | -1.06 |
| TPSA | 121.02 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.37 |
| LogP ≤ 5 | -1.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|