C23H28FN3O5S — CID 17224019
1-(4-fluorobenzoyl)-N-[4-(3-methoxypropylsulfamoyl)phenyl]piperidine-4-carboxamide (PubChem CID 17224019) has the molecular formula C23H28FN3O5S and a molecular weight of 477.56 g/mol. Its IUPAC name is 1-(4-fluorobenzoyl)-N-[4-(3-methoxypropylsulfamoyl)phenyl]piperidine-4-carboxamide.
| Compound Name | 1-(4-fluorobenzoyl)-N-[4-(3-methoxypropylsulfamoyl)phenyl]piperidine-4-carboxamide |
|---|---|
| PubChem CID | 17224019 |
| Molecular Formula | C23H28FN3O5S |
| Molecular Weight | 477.56 g/mol |
| Exact Mass | 477.17 |
| IUPAC Name | 1-(4-fluorobenzoyl)-N-[4-(3-methoxypropylsulfamoyl)phenyl]piperidine-4-carboxamide |
| SMILES | COCCCNS(=O)(=O)c1ccc(NC(=O)C2CCN(C(=O)c3ccc(F)cc3)CC2)cc1 |
| InChI | InChI=1S/C23H28FN3O5S/c1-32-16-2-13-25-33(30,31)21-9-7-20(8-10-21)26-22(28)17-11-14-27(15-12-17)23(29)18-3-5-19(24)6-4-18/h3-10,17,25H,2,11-16H2,1H3,(H,26,28) |
| InChIKey | ZOOLOZKUHTUGCS-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 104.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.56 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|