C25H29F4N3O6S — CID 146071605
N-butyl-1-[4-[(4-fluorophenyl)sulfonylamino]benzoyl]piperidine-4-carboxamide;2,2,2-trifluoroacetic acid (PubChem CID 146071605) has the molecular formula C25H29F4N3O6S and a molecular weight of 575.58 g/mol. Its IUPAC name is N-butyl-1-[4-[(4-fluorophenyl)sulfonylamino]benzoyl]piperidine-4-carboxamide;2,2,2-trifluoroacetic acid.
| Compound Name | N-butyl-1-[4-[(4-fluorophenyl)sulfonylamino]benzoyl]piperidine-4-carboxamide;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 146071605 |
| Molecular Formula | C25H29F4N3O6S |
| Molecular Weight | 575.58 g/mol |
| Exact Mass | 575.17 |
| IUPAC Name | N-butyl-1-[4-[(4-fluorophenyl)sulfonylamino]benzoyl]piperidine-4-carboxamide;2,2,2-trifluoroacetic acid |
| SMILES | CCCCNC(=O)C1CCN(C(=O)c2ccc(NS(=O)(=O)c3ccc(F)cc3)cc2)CC1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C23H28FN3O4S.C2HF3O2/c1-2-3-14-25-22(28)17-12-15-27(16-13-17)23(29)18-4-8-20(9-5-18)26-32(30,31)21-10-6-19(24)7-11-21;3-2(4,5)1(6)7/h4-11,17,26H,2-3,12-16H2,1H3,(H,25,28);(H,6,7) |
| InChIKey | WDQBPRPWFQIPKT-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 132.88 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 575.58 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|