C23H35N3O4S — CID 40830625
(3S)-1-cyclohexyl-N-[4-(dipropylsulfamoyl)phenyl]-5-oxopyrrolidine-3-carboxamide (PubChem CID 40830625) has the molecular formula C23H35N3O4S and a molecular weight of 449.62 g/mol. Its IUPAC name is (3S)-1-cyclohexyl-N-[4-(dipropylsulfamoyl)phenyl]-5-oxopyrrolidine-3-carboxamide.
| Compound Name | (3S)-1-cyclohexyl-N-[4-(dipropylsulfamoyl)phenyl]-5-oxopyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 40830625 |
| Molecular Formula | C23H35N3O4S |
| Molecular Weight | 449.62 g/mol |
| Exact Mass | 449.23 |
| IUPAC Name | (3S)-1-cyclohexyl-N-[4-(dipropylsulfamoyl)phenyl]-5-oxopyrrolidine-3-carboxamide |
| SMILES | CCCN(CCC)S(=O)(=O)c1ccc(NC(=O)[C@H]2CC(=O)N(C3CCCCC3)C2)cc1 |
| InChI | InChI=1S/C23H35N3O4S/c1-3-14-25(15-4-2)31(29,30)21-12-10-19(11-13-21)24-23(28)18-16-22(27)26(17-18)20-8-6-5-7-9-20/h10-13,18,20H,3-9,14-17H2,1-2H3,(H,24,28)/t18-/m0/s1 |
| InChIKey | MKVOGCWFGHDEPW-SFHVURJKSA-N |
| XLogP | 3.62 |
| TPSA | 86.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.62 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |