C21H25N5O4S — CID 51698449
(3S)-1-cyclohexyl-5-oxo-N-[4-(pyrimidin-2-ylsulfamoyl)phenyl]pyrrolidine-3-carboxamide (PubChem CID 51698449) has the molecular formula C21H25N5O4S and a molecular weight of 443.53 g/mol. Its IUPAC name is (3S)-1-cyclohexyl-5-oxo-N-[4-(pyrimidin-2-ylsulfamoyl)phenyl]pyrrolidine-3-carboxamide.
| Compound Name | (3S)-1-cyclohexyl-5-oxo-N-[4-(pyrimidin-2-ylsulfamoyl)phenyl]pyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 51698449 |
| Molecular Formula | C21H25N5O4S |
| Molecular Weight | 443.53 g/mol |
| Exact Mass | 443.16 |
| IUPAC Name | (3S)-1-cyclohexyl-5-oxo-N-[4-(pyrimidin-2-ylsulfamoyl)phenyl]pyrrolidine-3-carboxamide |
| SMILES | O=C(Nc1ccc(S(=O)(=O)Nc2ncccn2)cc1)[C@H]1CC(=O)N(C2CCCCC2)C1 |
| InChI | InChI=1S/C21H25N5O4S/c27-19-13-15(14-26(19)17-5-2-1-3-6-17)20(28)24-16-7-9-18(10-8-16)31(29,30)25-21-22-11-4-12-23-21/h4,7-12,15,17H,1-3,5-6,13-14H2,(H,24,28)(H,22,23,25)/t15-/m0/s1 |
| InChIKey | SNWPOWGIBAZLNI-HNNXBMFYSA-N |
| XLogP | 2.40 |
| TPSA | 121.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.53 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |