C22H21N5O4S — CID 17120650
1-(3-methylphenyl)-5-oxo-N-[4-(pyrimidin-2-ylsulfamoyl)phenyl]pyrrolidine-3-carboxamide (PubChem CID 17120650) has the molecular formula C22H21N5O4S and a molecular weight of 451.51 g/mol. Its IUPAC name is 1-(3-methylphenyl)-5-oxo-N-[4-(pyrimidin-2-ylsulfamoyl)phenyl]pyrrolidine-3-carboxamide.
| Compound Name | 1-(3-methylphenyl)-5-oxo-N-[4-(pyrimidin-2-ylsulfamoyl)phenyl]pyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 17120650 |
| Molecular Formula | C22H21N5O4S |
| Molecular Weight | 451.51 g/mol |
| Exact Mass | 451.13 |
| IUPAC Name | 1-(3-methylphenyl)-5-oxo-N-[4-(pyrimidin-2-ylsulfamoyl)phenyl]pyrrolidine-3-carboxamide |
| SMILES | Cc1cccc(N2CC(C(=O)Nc3ccc(S(=O)(=O)Nc4ncccn4)cc3)CC2=O)c1 |
| InChI | InChI=1S/C22H21N5O4S/c1-15-4-2-5-18(12-15)27-14-16(13-20(27)28)21(29)25-17-6-8-19(9-7-17)32(30,31)26-22-23-10-3-11-24-22/h2-12,16H,13-14H2,1H3,(H,25,29)(H,23,24,26) |
| InChIKey | UCODIVMPKKKJCS-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 121.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.51 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |