C27H30ClN3O3S — CID 1056916
N-[4-[4-(4-tert-butylbenzoyl)piperazin-1-yl]phenyl]-4-chlorobenzenesulfonamide (PubChem CID 1056916) has the molecular formula C27H30ClN3O3S and a molecular weight of 512.08 g/mol. Its IUPAC name is N-[4-[4-(4-tert-butylbenzoyl)piperazin-1-yl]phenyl]-4-chlorobenzenesulfonamide.
| Compound Name | N-[4-[4-(4-tert-butylbenzoyl)piperazin-1-yl]phenyl]-4-chlorobenzenesulfonamide |
|---|---|
| PubChem CID | 1056916 |
| Molecular Formula | C27H30ClN3O3S |
| Molecular Weight | 512.08 g/mol |
| Exact Mass | 511.17 |
| IUPAC Name | N-[4-[4-(4-tert-butylbenzoyl)piperazin-1-yl]phenyl]-4-chlorobenzenesulfonamide |
| SMILES | CC(C)(C)c1ccc(C(=O)N2CCN(c3ccc(NS(=O)(=O)c4ccc(Cl)cc4)cc3)CC2)cc1 |
| InChI | InChI=1S/C27H30ClN3O3S/c1-27(2,3)21-6-4-20(5-7-21)26(32)31-18-16-30(17-19-31)24-12-10-23(11-13-24)29-35(33,34)25-14-8-22(28)9-15-25/h4-15,29H,16-19H2,1-3H3 |
| InChIKey | BVSDKHFYICMXAH-UHFFFAOYSA-N |
| XLogP | 5.40 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.08 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|