C19H20ClN3O2 — CID 2994878
N-[4-[4-(4-chlorobenzoyl)piperazin-1-yl]phenyl]acetamide (PubChem CID 2994878) has the molecular formula C19H20ClN3O2 and a molecular weight of 357.84 g/mol. Its IUPAC name is N-[4-[4-(4-chlorobenzoyl)piperazin-1-yl]phenyl]acetamide.
| Compound Name | N-[4-[4-(4-chlorobenzoyl)piperazin-1-yl]phenyl]acetamide |
|---|---|
| PubChem CID | 2994878 |
| Molecular Formula | C19H20ClN3O2 |
| Molecular Weight | 357.84 g/mol |
| Exact Mass | 357.12 |
| IUPAC Name | N-[4-[4-(4-chlorobenzoyl)piperazin-1-yl]phenyl]acetamide |
| SMILES | CC(=O)Nc1ccc(N2CCN(C(=O)c3ccc(Cl)cc3)CC2)cc1 |
| InChI | InChI=1S/C19H20ClN3O2/c1-14(24)21-17-6-8-18(9-7-17)22-10-12-23(13-11-22)19(25)15-2-4-16(20)5-3-15/h2-9H,10-13H2,1H3,(H,21,24) |
| InChIKey | KYVIJNXKFUSODJ-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.84 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|