C26H34N2O4 — CID 55392170
(2-oxo-1-phenyl-2-pyrrolidin-1-ylethyl) 3-(adamantane-1-carbonylamino)propanoate (PubChem CID 55392170) has the molecular formula C26H34N2O4 and a molecular weight of 438.57 g/mol. Its IUPAC name is (2-oxo-1-phenyl-2-pyrrolidin-1-ylethyl) 3-(adamantane-1-carbonylamino)propanoate.
| Compound Name | (2-oxo-1-phenyl-2-pyrrolidin-1-ylethyl) 3-(adamantane-1-carbonylamino)propanoate |
|---|---|
| PubChem CID | 55392170 |
| Molecular Formula | C26H34N2O4 |
| Molecular Weight | 438.57 g/mol |
| Exact Mass | 438.25 |
| IUPAC Name | (2-oxo-1-phenyl-2-pyrrolidin-1-ylethyl) 3-(adamantane-1-carbonylamino)propanoate |
| SMILES | O=C(CCNC(=O)C12CC3CC(CC(C3)C1)C2)OC(C(=O)N1CCCC1)c1ccccc1 |
| InChI | InChI=1S/C26H34N2O4/c29-22(32-23(21-6-2-1-3-7-21)24(30)28-10-4-5-11-28)8-9-27-25(31)26-15-18-12-19(16-26)14-20(13-18)17-26/h1-3,6-7,18-20,23H,4-5,8-17H2,(H,27,31) |
| InChIKey | DYESWNJADKURGT-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.57 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |