C27H38N2O4 — CID 55366093
[1-oxo-1-(1-phenylbutylamino)propan-2-yl] 3-(adamantane-1-carbonylamino)propanoate (PubChem CID 55366093) has the molecular formula C27H38N2O4 and a molecular weight of 454.61 g/mol. Its IUPAC name is [1-oxo-1-(1-phenylbutylamino)propan-2-yl] 3-(adamantane-1-carbonylamino)propanoate.
| Compound Name | [1-oxo-1-(1-phenylbutylamino)propan-2-yl] 3-(adamantane-1-carbonylamino)propanoate |
|---|---|
| PubChem CID | 55366093 |
| Molecular Formula | C27H38N2O4 |
| Molecular Weight | 454.61 g/mol |
| Exact Mass | 454.28 |
| IUPAC Name | [1-oxo-1-(1-phenylbutylamino)propan-2-yl] 3-(adamantane-1-carbonylamino)propanoate |
| SMILES | CCCC(NC(=O)C(C)OC(=O)CCNC(=O)C12CC3CC(CC(C3)C1)C2)c1ccccc1 |
| InChI | InChI=1S/C27H38N2O4/c1-3-7-23(22-8-5-4-6-9-22)29-25(31)18(2)33-24(30)10-11-28-26(32)27-15-19-12-20(16-27)14-21(13-19)17-27/h4-6,8-9,18-21,23H,3,7,10-17H2,1-2H3,(H,28,32)(H,29,31) |
| InChIKey | BFTZEHFEJMJRIT-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.61 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |