C26H34N2O5S — CID 55442495
[1-oxo-1-(1-phenylbutylamino)propan-2-yl] 3-(4-pyrrolidin-1-ylsulfonylphenyl)propanoate (PubChem CID 55442495) has the molecular formula C26H34N2O5S and a molecular weight of 486.63 g/mol. Its IUPAC name is [1-oxo-1-(1-phenylbutylamino)propan-2-yl] 3-(4-pyrrolidin-1-ylsulfonylphenyl)propanoate.
| Compound Name | [1-oxo-1-(1-phenylbutylamino)propan-2-yl] 3-(4-pyrrolidin-1-ylsulfonylphenyl)propanoate |
|---|---|
| PubChem CID | 55442495 |
| Molecular Formula | C26H34N2O5S |
| Molecular Weight | 486.63 g/mol |
| Exact Mass | 486.22 |
| IUPAC Name | [1-oxo-1-(1-phenylbutylamino)propan-2-yl] 3-(4-pyrrolidin-1-ylsulfonylphenyl)propanoate |
| SMILES | CCCC(NC(=O)C(C)OC(=O)CCc1ccc(S(=O)(=O)N2CCCC2)cc1)c1ccccc1 |
| InChI | InChI=1S/C26H34N2O5S/c1-3-9-24(22-10-5-4-6-11-22)27-26(30)20(2)33-25(29)17-14-21-12-15-23(16-13-21)34(31,32)28-18-7-8-19-28/h4-6,10-13,15-16,20,24H,3,7-9,14,17-19H2,1-2H3,(H,27,30) |
| InChIKey | GYFMNIMUDVQPQW-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 92.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.63 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |