C24H30N2O5S — CID 46483405
methyl 3-phenyl-3-[3-(4-piperidin-1-ylsulfonylphenyl)propanoylamino]propanoate (PubChem CID 46483405) has the molecular formula C24H30N2O5S and a molecular weight of 458.58 g/mol. Its IUPAC name is methyl 3-phenyl-3-[3-(4-piperidin-1-ylsulfonylphenyl)propanoylamino]propanoate.
| Compound Name | methyl 3-phenyl-3-[3-(4-piperidin-1-ylsulfonylphenyl)propanoylamino]propanoate |
|---|---|
| PubChem CID | 46483405 |
| Molecular Formula | C24H30N2O5S |
| Molecular Weight | 458.58 g/mol |
| Exact Mass | 458.19 |
| IUPAC Name | methyl 3-phenyl-3-[3-(4-piperidin-1-ylsulfonylphenyl)propanoylamino]propanoate |
| SMILES | COC(=O)CC(NC(=O)CCc1ccc(S(=O)(=O)N2CCCCC2)cc1)c1ccccc1 |
| InChI | InChI=1S/C24H30N2O5S/c1-31-24(28)18-22(20-8-4-2-5-9-20)25-23(27)15-12-19-10-13-21(14-11-19)32(29,30)26-16-6-3-7-17-26/h2,4-5,8-11,13-14,22H,3,6-7,12,15-18H2,1H3,(H,25,27) |
| InChIKey | SLHZZIFSDWFCMP-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 92.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.58 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |