C24H27N3O5S — CID 55315367
[1-(3-cyanoanilino)-1-oxopropan-2-yl] 3-(4-piperidin-1-ylsulfonylphenyl)propanoate (PubChem CID 55315367) has the molecular formula C24H27N3O5S and a molecular weight of 469.56 g/mol. Its IUPAC name is [1-(3-cyanoanilino)-1-oxopropan-2-yl] 3-(4-piperidin-1-ylsulfonylphenyl)propanoate.
| Compound Name | [1-(3-cyanoanilino)-1-oxopropan-2-yl] 3-(4-piperidin-1-ylsulfonylphenyl)propanoate |
|---|---|
| PubChem CID | 55315367 |
| Molecular Formula | C24H27N3O5S |
| Molecular Weight | 469.56 g/mol |
| Exact Mass | 469.17 |
| IUPAC Name | [1-(3-cyanoanilino)-1-oxopropan-2-yl] 3-(4-piperidin-1-ylsulfonylphenyl)propanoate |
| SMILES | CC(OC(=O)CCc1ccc(S(=O)(=O)N2CCCCC2)cc1)C(=O)Nc1cccc(C#N)c1 |
| InChI | InChI=1S/C24H27N3O5S/c1-18(24(29)26-21-7-5-6-20(16-21)17-25)32-23(28)13-10-19-8-11-22(12-9-19)33(30,31)27-14-3-2-4-15-27/h5-9,11-12,16,18H,2-4,10,13-15H2,1H3,(H,26,29) |
| InChIKey | FVPCEGBKDSDTFC-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 116.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.56 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |