C25H32N2O4 — CID 8601927
[(1R)-2-(cyclopropylamino)-2-oxo-1-phenylethyl] 3-(adamantane-1-carbonylamino)propanoate (PubChem CID 8601927) has the molecular formula C25H32N2O4 and a molecular weight of 424.54 g/mol. Its IUPAC name is [(1R)-2-(cyclopropylamino)-2-oxo-1-phenylethyl] 3-(adamantane-1-carbonylamino)propanoate.
| Compound Name | [(1R)-2-(cyclopropylamino)-2-oxo-1-phenylethyl] 3-(adamantane-1-carbonylamino)propanoate |
|---|---|
| PubChem CID | 8601927 |
| Molecular Formula | C25H32N2O4 |
| Molecular Weight | 424.54 g/mol |
| Exact Mass | 424.24 |
| IUPAC Name | [(1R)-2-(cyclopropylamino)-2-oxo-1-phenylethyl] 3-(adamantane-1-carbonylamino)propanoate |
| SMILES | O=C(CCNC(=O)C12CC3CC(CC(C3)C1)C2)O[C@@H](C(=O)NC1CC1)c1ccccc1 |
| InChI | InChI=1S/C25H32N2O4/c28-21(31-22(19-4-2-1-3-5-19)23(29)27-20-6-7-20)8-9-26-24(30)25-13-16-10-17(14-25)12-18(11-16)15-25/h1-5,16-18,20,22H,6-15H2,(H,26,30)(H,27,29)/t16?,17?,18?,22-,25?/m1/s1 |
| InChIKey | CNKDRQBPAUOUBS-DRQCUQGNSA-N |
| XLogP | 3.27 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.54 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |