C26H38N2O — CID 140543011
N-[4-[dimethylamino(phenyl)methyl]cyclohexyl]adamantane-1-carboxamide (PubChem CID 140543011) has the molecular formula C26H38N2O and a molecular weight of 394.60 g/mol. Its IUPAC name is N-[4-[dimethylamino(phenyl)methyl]cyclohexyl]adamantane-1-carboxamide.
| Compound Name | N-[4-[dimethylamino(phenyl)methyl]cyclohexyl]adamantane-1-carboxamide |
|---|---|
| PubChem CID | 140543011 |
| Molecular Formula | C26H38N2O |
| Molecular Weight | 394.60 g/mol |
| Exact Mass | 394.30 |
| IUPAC Name | N-[4-[dimethylamino(phenyl)methyl]cyclohexyl]adamantane-1-carboxamide |
| SMILES | CN(C)C(c1ccccc1)C1CCC(NC(=O)C23CC4CC(CC(C4)C2)C3)CC1 |
| InChI | InChI=1S/C26H38N2O/c1-28(2)24(21-6-4-3-5-7-21)22-8-10-23(11-9-22)27-25(29)26-15-18-12-19(16-26)14-20(13-18)17-26/h3-7,18-20,22-24H,8-17H2,1-2H3,(H,27,29) |
| InChIKey | GWQDOJZUPPMQLV-UHFFFAOYSA-N |
| XLogP | 5.18 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.60 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |