C15H24N2O2 — CID 2869304
N'-(2-methylpropanoyl)adamantane-1-carbohydrazide (PubChem CID 2869304) has the molecular formula C15H24N2O2 and a molecular weight of 264.37 g/mol. Its IUPAC name is N'-(2-methylpropanoyl)adamantane-1-carbohydrazide.
| Compound Name | N'-(2-methylpropanoyl)adamantane-1-carbohydrazide |
|---|---|
| PubChem CID | 2869304 |
| Molecular Formula | C15H24N2O2 |
| Molecular Weight | 264.37 g/mol |
| Exact Mass | 264.18 |
| IUPAC Name | N'-(2-methylpropanoyl)adamantane-1-carbohydrazide |
| SMILES | CC(C)C(=O)NNC(=O)C12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C15H24N2O2/c1-9(2)13(18)16-17-14(19)15-6-10-3-11(7-15)5-12(4-10)8-15/h9-12H,3-8H2,1-2H3,(H,16,18)(H,17,19) |
| InChIKey | CRSKJIOHWZNSOM-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.37 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|