C24H33N3O3 — CID 7613266
N-[(2S,3S)-1-[2-(adamantane-1-carbonyl)hydrazinyl]-3-methyl-1-oxopentan-2-yl]benzamide (PubChem CID 7613266) has the molecular formula C24H33N3O3 and a molecular weight of 411.55 g/mol. Its IUPAC name is N-[(2S,3S)-1-[2-(adamantane-1-carbonyl)hydrazinyl]-3-methyl-1-oxopentan-2-yl]benzamide.
| Compound Name | N-[(2S,3S)-1-[2-(adamantane-1-carbonyl)hydrazinyl]-3-methyl-1-oxopentan-2-yl]benzamide |
|---|---|
| PubChem CID | 7613266 |
| Molecular Formula | C24H33N3O3 |
| Molecular Weight | 411.55 g/mol |
| Exact Mass | 411.25 |
| IUPAC Name | N-[(2S,3S)-1-[2-(adamantane-1-carbonyl)hydrazinyl]-3-methyl-1-oxopentan-2-yl]benzamide |
| SMILES | CC[C@H](C)[C@H](NC(=O)c1ccccc1)C(=O)NNC(=O)C12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C24H33N3O3/c1-3-15(2)20(25-21(28)19-7-5-4-6-8-19)22(29)26-27-23(30)24-12-16-9-17(13-24)11-18(10-16)14-24/h4-8,15-18,20H,3,9-14H2,1-2H3,(H,25,28)(H,26,29)(H,27,30)/t15-,16?,17?,18?,20-,24?/m0/s1 |
| InChIKey | RQPFKHMGUGYOPC-HNVJMHORSA-N |
| XLogP | 3.19 |
| TPSA | 87.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.55 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|