C21H36N4O2S — CID 9425931
N-[(2S)-1-[2-(tert-butylcarbamothioyl)hydrazinyl]-3-methyl-1-oxobutan-2-yl]adamantane-1-carboxamide (PubChem CID 9425931) has the molecular formula C21H36N4O2S and a molecular weight of 408.61 g/mol. Its IUPAC name is N-[(2S)-1-[2-(tert-butylcarbamothioyl)hydrazinyl]-3-methyl-1-oxobutan-2-yl]adamantane-1-carboxamide.
| Compound Name | N-[(2S)-1-[2-(tert-butylcarbamothioyl)hydrazinyl]-3-methyl-1-oxobutan-2-yl]adamantane-1-carboxamide |
|---|---|
| PubChem CID | 9425931 |
| Molecular Formula | C21H36N4O2S |
| Molecular Weight | 408.61 g/mol |
| Exact Mass | 408.26 |
| IUPAC Name | N-[(2S)-1-[2-(tert-butylcarbamothioyl)hydrazinyl]-3-methyl-1-oxobutan-2-yl]adamantane-1-carboxamide |
| SMILES | CC(C)[C@H](NC(=O)C12CC3CC(CC(C3)C1)C2)C(=O)NNC(=S)NC(C)(C)C |
| InChI | InChI=1S/C21H36N4O2S/c1-12(2)16(17(26)24-25-19(28)23-20(3,4)5)22-18(27)21-9-13-6-14(10-21)8-15(7-13)11-21/h12-16H,6-11H2,1-5H3,(H,22,27)(H,24,26)(H2,23,25,28)/t13?,14?,15?,16-,21?/m0/s1 |
| InChIKey | FBQASWCWWDTJAJ-IIFATDLDSA-N |
| XLogP | 2.64 |
| TPSA | 82.26 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.61 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|