C18H17ClN2O2 — CID 9328814
N'-(3-chlorobenzoyl)-5,6,7,8-tetrahydronaphthalene-2-carbohydrazide (PubChem CID 9328814) has the molecular formula C18H17ClN2O2 and a molecular weight of 328.80 g/mol. Its IUPAC name is N'-(3-chlorobenzoyl)-5,6,7,8-tetrahydronaphthalene-2-carbohydrazide.
| Compound Name | N'-(3-chlorobenzoyl)-5,6,7,8-tetrahydronaphthalene-2-carbohydrazide |
|---|---|
| PubChem CID | 9328814 |
| Molecular Formula | C18H17ClN2O2 |
| Molecular Weight | 328.80 g/mol |
| Exact Mass | 328.10 |
| IUPAC Name | N'-(3-chlorobenzoyl)-5,6,7,8-tetrahydronaphthalene-2-carbohydrazide |
| SMILES | O=C(NNC(=O)c1ccc2c(c1)CCCC2)c1cccc(Cl)c1 |
| InChI | InChI=1S/C18H17ClN2O2/c19-16-7-3-6-14(11-16)17(22)20-21-18(23)15-9-8-12-4-1-2-5-13(12)10-15/h3,6-11H,1-2,4-5H2,(H,20,22)(H,21,23) |
| InChIKey | CUPNSFVZORGMAU-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.80 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|