C33H46O4 — CID 158328146
4-butan-2-yl-2-methoxyphenol;(4-butan-2-yl-2-methylphenyl) adamantane-1-carboxylate (PubChem CID 158328146) has the molecular formula C33H46O4 and a molecular weight of 506.73 g/mol. Its IUPAC name is 4-butan-2-yl-2-methoxyphenol;(4-butan-2-yl-2-methylphenyl) adamantane-1-carboxylate.
| Compound Name | 4-butan-2-yl-2-methoxyphenol;(4-butan-2-yl-2-methylphenyl) adamantane-1-carboxylate |
|---|---|
| PubChem CID | 158328146 |
| Molecular Formula | C33H46O4 |
| Molecular Weight | 506.73 g/mol |
| Exact Mass | 506.34 |
| IUPAC Name | 4-butan-2-yl-2-methoxyphenol;(4-butan-2-yl-2-methylphenyl) adamantane-1-carboxylate |
| SMILES | CCC(C)c1ccc(O)c(OC)c1.CCC(C)c1ccc(OC(=O)C23CC4CC(CC(C4)C2)C3)c(C)c1 |
| InChI | InChI=1S/C22H30O2.C11H16O2/c1-4-14(2)19-5-6-20(15(3)7-19)24-21(23)22-11-16-8-17(12-22)10-18(9-16)13-22;1-4-8(2)9-5-6-10(12)11(7-9)13-3/h5-7,14,16-18H,4,8-13H2,1-3H3;5-8,12H,4H2,1-3H3 |
| InChIKey | GPQYPGANAJFDDS-UHFFFAOYSA-N |
| XLogP | 8.54 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.73 |
| LogP ≤ 5 | 8.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|