C25H33NO4 — CID 7873759
[2-[4-(hexanoylamino)phenyl]-2-oxoethyl] adamantane-1-carboxylate (PubChem CID 7873759) has the molecular formula C25H33NO4 and a molecular weight of 411.54 g/mol. Its IUPAC name is [2-[4-(hexanoylamino)phenyl]-2-oxoethyl] adamantane-1-carboxylate.
| Compound Name | [2-[4-(hexanoylamino)phenyl]-2-oxoethyl] adamantane-1-carboxylate |
|---|---|
| PubChem CID | 7873759 |
| Molecular Formula | C25H33NO4 |
| Molecular Weight | 411.54 g/mol |
| Exact Mass | 411.24 |
| IUPAC Name | [2-[4-(hexanoylamino)phenyl]-2-oxoethyl] adamantane-1-carboxylate |
| SMILES | CCCCCC(=O)Nc1ccc(C(=O)COC(=O)C23CC4CC(CC(C4)C2)C3)cc1 |
| InChI | InChI=1S/C25H33NO4/c1-2-3-4-5-23(28)26-21-8-6-20(7-9-21)22(27)16-30-24(29)25-13-17-10-18(14-25)12-19(11-17)15-25/h6-9,17-19H,2-5,10-16H2,1H3,(H,26,28) |
| InChIKey | NWHMBQAMLBAFOE-UHFFFAOYSA-N |
| XLogP | 5.15 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.54 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|