C14H15Cl2NO4 — CID 2619068
[2-(3-methoxyanilino)-2-oxoethyl] (1S)-2,2-dichloro-1-methylcyclopropane-1-carboxylate (PubChem CID 2619068) has the molecular formula C14H15Cl2NO4 and a molecular weight of 332.18 g/mol. Its IUPAC name is [2-(3-methoxyanilino)-2-oxoethyl] (1S)-2,2-dichloro-1-methylcyclopropane-1-carboxylate.
| Compound Name | [2-(3-methoxyanilino)-2-oxoethyl] (1S)-2,2-dichloro-1-methylcyclopropane-1-carboxylate |
|---|---|
| PubChem CID | 2619068 |
| Molecular Formula | C14H15Cl2NO4 |
| Molecular Weight | 332.18 g/mol |
| Exact Mass | 331.04 |
| IUPAC Name | [2-(3-methoxyanilino)-2-oxoethyl] (1S)-2,2-dichloro-1-methylcyclopropane-1-carboxylate |
| SMILES | COc1cccc(NC(=O)COC(=O)[C@]2(C)CC2(Cl)Cl)c1 |
| InChI | InChI=1S/C14H15Cl2NO4/c1-13(8-14(13,15)16)12(19)21-7-11(18)17-9-4-3-5-10(6-9)20-2/h3-6H,7-8H2,1-2H3,(H,17,18)/t13-/m0/s1 |
| InChIKey | MNWUIKYCVIDGCD-ZDUSSCGKSA-N |
| XLogP | 2.76 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.18 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|