C21H27NO3 — CID 51460091
(2-amino-2-oxoethyl) (5S,7R)-3-(3,4-dimethylphenyl)adamantane-1-carboxylate (PubChem CID 51460091) has the molecular formula C21H27NO3 and a molecular weight of 341.45 g/mol. Its IUPAC name is (2-amino-2-oxoethyl) (5S,7R)-3-(3,4-dimethylphenyl)adamantane-1-carboxylate.
| Compound Name | (2-amino-2-oxoethyl) (5S,7R)-3-(3,4-dimethylphenyl)adamantane-1-carboxylate |
|---|---|
| PubChem CID | 51460091 |
| Molecular Formula | C21H27NO3 |
| Molecular Weight | 341.45 g/mol |
| Exact Mass | 341.20 |
| IUPAC Name | (2-amino-2-oxoethyl) (5S,7R)-3-(3,4-dimethylphenyl)adamantane-1-carboxylate |
| SMILES | Cc1ccc(C23C[C@@H]4C[C@@H](CC(C(=O)OCC(N)=O)(C4)C2)C3)cc1C |
| InChI | InChI=1S/C21H27NO3/c1-13-3-4-17(5-14(13)2)20-7-15-6-16(8-20)10-21(9-15,12-20)19(24)25-11-18(22)23/h3-5,15-16H,6-12H2,1-2H3,(H2,22,23)/t15-,16+,20?,21? |
| InChIKey | GECHZVREUGKWSI-XBLGPDGASA-N |
| XLogP | 3.17 |
| TPSA | 69.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.45 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |