C21H27NO4 — CID 55916613
methyl 2-[4-(adamantane-1-carbonylamino)-3-methylphenoxy]acetate (PubChem CID 55916613) has the molecular formula C21H27NO4 and a molecular weight of 357.45 g/mol. Its IUPAC name is methyl 2-[4-(adamantane-1-carbonylamino)-3-methylphenoxy]acetate.
| Compound Name | methyl 2-[4-(adamantane-1-carbonylamino)-3-methylphenoxy]acetate |
|---|---|
| PubChem CID | 55916613 |
| Molecular Formula | C21H27NO4 |
| Molecular Weight | 357.45 g/mol |
| Exact Mass | 357.19 |
| IUPAC Name | methyl 2-[4-(adamantane-1-carbonylamino)-3-methylphenoxy]acetate |
| SMILES | COC(=O)COc1ccc(NC(=O)C23CC4CC(CC(C4)C2)C3)c(C)c1 |
| InChI | InChI=1S/C21H27NO4/c1-13-5-17(26-12-19(23)25-2)3-4-18(13)22-20(24)21-9-14-6-15(10-21)8-16(7-14)11-21/h3-5,14-16H,6-12H2,1-2H3,(H,22,24) |
| InChIKey | WLVZWBOPZJCKGO-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.45 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |