C18H21NO6 — CID 47062070
6-[[4-(2-methoxy-2-oxoethoxy)-2-methylphenyl]carbamoyl]cyclohex-3-ene-1-carboxylic acid (PubChem CID 47062070) has the molecular formula C18H21NO6 and a molecular weight of 347.37 g/mol. Its IUPAC name is 6-[[4-(2-methoxy-2-oxoethoxy)-2-methylphenyl]carbamoyl]cyclohex-3-ene-1-carboxylic acid.
| Compound Name | 6-[[4-(2-methoxy-2-oxoethoxy)-2-methylphenyl]carbamoyl]cyclohex-3-ene-1-carboxylic acid |
|---|---|
| PubChem CID | 47062070 |
| Molecular Formula | C18H21NO6 |
| Molecular Weight | 347.37 g/mol |
| Exact Mass | 347.14 |
| IUPAC Name | 6-[[4-(2-methoxy-2-oxoethoxy)-2-methylphenyl]carbamoyl]cyclohex-3-ene-1-carboxylic acid |
| SMILES | COC(=O)COc1ccc(NC(=O)C2CC=CCC2C(=O)O)c(C)c1 |
| InChI | InChI=1S/C18H21NO6/c1-11-9-12(25-10-16(20)24-2)7-8-15(11)19-17(21)13-5-3-4-6-14(13)18(22)23/h3-4,7-9,13-14H,5-6,10H2,1-2H3,(H,19,21)(H,22,23) |
| InChIKey | WUSZHFIMKPPQFU-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 101.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.37 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|