C19H26N2O5 — CID 55915477
methyl 2-[3-methyl-4-[(1-propanoylpiperidine-2-carbonyl)amino]phenoxy]acetate (PubChem CID 55915477) has the molecular formula C19H26N2O5 and a molecular weight of 362.43 g/mol. Its IUPAC name is methyl 2-[3-methyl-4-[(1-propanoylpiperidine-2-carbonyl)amino]phenoxy]acetate.
| Compound Name | methyl 2-[3-methyl-4-[(1-propanoylpiperidine-2-carbonyl)amino]phenoxy]acetate |
|---|---|
| PubChem CID | 55915477 |
| Molecular Formula | C19H26N2O5 |
| Molecular Weight | 362.43 g/mol |
| Exact Mass | 362.18 |
| IUPAC Name | methyl 2-[3-methyl-4-[(1-propanoylpiperidine-2-carbonyl)amino]phenoxy]acetate |
| SMILES | CCC(=O)N1CCCCC1C(=O)Nc1ccc(OCC(=O)OC)cc1C |
| InChI | InChI=1S/C19H26N2O5/c1-4-17(22)21-10-6-5-7-16(21)19(24)20-15-9-8-14(11-13(15)2)26-12-18(23)25-3/h8-9,11,16H,4-7,10,12H2,1-3H3,(H,20,24) |
| InChIKey | OIVLOVBAVUVZGQ-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.43 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |