C19H25NO4 — CID 4018470
N-(3-hydroxy-4,5-dimethoxyphenyl)adamantane-1-carboxamide (PubChem CID 4018470) has the molecular formula C19H25NO4 and a molecular weight of 331.41 g/mol. Its IUPAC name is N-(3-hydroxy-4,5-dimethoxyphenyl)adamantane-1-carboxamide.
| Compound Name | N-(3-hydroxy-4,5-dimethoxyphenyl)adamantane-1-carboxamide |
|---|---|
| PubChem CID | 4018470 |
| Molecular Formula | C19H25NO4 |
| Molecular Weight | 331.41 g/mol |
| Exact Mass | 331.18 |
| IUPAC Name | N-(3-hydroxy-4,5-dimethoxyphenyl)adamantane-1-carboxamide |
| SMILES | COc1cc(NC(=O)C23CC4CC(CC(C4)C2)C3)cc(O)c1OC |
| InChI | InChI=1S/C19H25NO4/c1-23-16-7-14(6-15(21)17(16)24-2)20-18(22)19-8-11-3-12(9-19)5-13(4-11)10-19/h6-7,11-13,21H,3-5,8-10H2,1-2H3,(H,20,22) |
| InChIKey | XZWDWPNRWNSFDI-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 67.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.41 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |