C15H18N2O2 — CID 122134376
2-N-(2,3-dihydro-1H-inden-5-yl)cyclobutane-1,2-dicarboxamide (PubChem CID 122134376) has the molecular formula C15H18N2O2 and a molecular weight of 258.32 g/mol. Its IUPAC name is 2-N-(2,3-dihydro-1H-inden-5-yl)cyclobutane-1,2-dicarboxamide.
| Compound Name | 2-N-(2,3-dihydro-1H-inden-5-yl)cyclobutane-1,2-dicarboxamide |
|---|---|
| PubChem CID | 122134376 |
| Molecular Formula | C15H18N2O2 |
| Molecular Weight | 258.32 g/mol |
| Exact Mass | 258.14 |
| IUPAC Name | 2-N-(2,3-dihydro-1H-inden-5-yl)cyclobutane-1,2-dicarboxamide |
| SMILES | NC(=O)C1CCC1C(=O)Nc1ccc2c(c1)CCC2 |
| InChI | InChI=1S/C15H18N2O2/c16-14(18)12-6-7-13(12)15(19)17-11-5-4-9-2-1-3-10(9)8-11/h4-5,8,12-13H,1-3,6-7H2,(H2,16,18)(H,17,19) |
| InChIKey | LBVZEUINJWLGBH-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.32 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |