C18H24N2O — CID 166229686
1-(2,3-dihydro-1H-inden-5-yl)-3-spiro[2.5]octan-6-ylurea (PubChem CID 166229686) has the molecular formula C18H24N2O and a molecular weight of 284.40 g/mol. Its IUPAC name is 1-(2,3-dihydro-1H-inden-5-yl)-3-spiro[2.5]octan-6-ylurea.
| Compound Name | 1-(2,3-dihydro-1H-inden-5-yl)-3-spiro[2.5]octan-6-ylurea |
|---|---|
| PubChem CID | 166229686 |
| Molecular Formula | C18H24N2O |
| Molecular Weight | 284.40 g/mol |
| Exact Mass | 284.19 |
| IUPAC Name | 1-(2,3-dihydro-1H-inden-5-yl)-3-spiro[2.5]octan-6-ylurea |
| SMILES | O=C(Nc1ccc2c(c1)CCC2)NC1CCC2(CC1)CC2 |
| InChI | InChI=1S/C18H24N2O/c21-17(19-15-6-8-18(9-7-15)10-11-18)20-16-5-4-13-2-1-3-14(13)12-16/h4-5,12,15H,1-3,6-11H2,(H2,19,20,21) |
| InChIKey | WUIVZYPILHEIFM-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.40 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |