C16H19N3O — CID 97347739
1-[(1S,2R)-2-cyanocyclopentyl]-3-(2,3-dihydro-1H-inden-5-yl)urea (PubChem CID 97347739) has the molecular formula C16H19N3O and a molecular weight of 269.35 g/mol. Its IUPAC name is 1-[(1S,2R)-2-cyanocyclopentyl]-3-(2,3-dihydro-1H-inden-5-yl)urea.
| Compound Name | 1-[(1S,2R)-2-cyanocyclopentyl]-3-(2,3-dihydro-1H-inden-5-yl)urea |
|---|---|
| PubChem CID | 97347739 |
| Molecular Formula | C16H19N3O |
| Molecular Weight | 269.35 g/mol |
| Exact Mass | 269.15 |
| IUPAC Name | 1-[(1S,2R)-2-cyanocyclopentyl]-3-(2,3-dihydro-1H-inden-5-yl)urea |
| SMILES | N#C[C@@H]1CCC[C@@H]1NC(=O)Nc1ccc2c(c1)CCC2 |
| InChI | InChI=1S/C16H19N3O/c17-10-13-5-2-6-15(13)19-16(20)18-14-8-7-11-3-1-4-12(11)9-14/h7-9,13,15H,1-6H2,(H2,18,19,20)/t13-,15-/m0/s1 |
| InChIKey | KCSIQBZFBRKJRP-ZFWWWQNUSA-N |
| XLogP | 2.99 |
| TPSA | 64.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.35 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |