C10H12N2OS — CID 115223650
5-(2-sulfanylethylamino)-1,3-dihydroindol-2-one (PubChem CID 115223650) has the molecular formula C10H12N2OS and a molecular weight of 208.29 g/mol. Its IUPAC name is 5-(2-sulfanylethylamino)-1,3-dihydroindol-2-one.
| Compound Name | 5-(2-sulfanylethylamino)-1,3-dihydroindol-2-one |
|---|---|
| PubChem CID | 115223650 |
| Molecular Formula | C10H12N2OS |
| Molecular Weight | 208.29 g/mol |
| Exact Mass | 208.07 |
| IUPAC Name | 5-(2-sulfanylethylamino)-1,3-dihydroindol-2-one |
| SMILES | O=C1Cc2cc(NCCS)ccc2N1 |
| InChI | InChI=1S/C10H12N2OS/c13-10-6-7-5-8(11-3-4-14)1-2-9(7)12-10/h1-2,5,11,14H,3-4,6H2,(H,12,13) |
| InChIKey | KLDJXFVOEQMERX-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.29 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|