C18H16N4O2 — CID 14476472
1-(4-cyanophenyl)-3-(3,3-dimethyl-2-oxo-1H-indol-6-yl)urea (PubChem CID 14476472) has the molecular formula C18H16N4O2 and a molecular weight of 320.35 g/mol. Its IUPAC name is 1-(4-cyanophenyl)-3-(3,3-dimethyl-2-oxo-1H-indol-6-yl)urea.
| Compound Name | 1-(4-cyanophenyl)-3-(3,3-dimethyl-2-oxo-1H-indol-6-yl)urea |
|---|---|
| PubChem CID | 14476472 |
| Molecular Formula | C18H16N4O2 |
| Molecular Weight | 320.35 g/mol |
| Exact Mass | 320.13 |
| IUPAC Name | 1-(4-cyanophenyl)-3-(3,3-dimethyl-2-oxo-1H-indol-6-yl)urea |
| SMILES | CC1(C)C(=O)Nc2cc(NC(=O)Nc3ccc(C#N)cc3)ccc21 |
| InChI | InChI=1S/C18H16N4O2/c1-18(2)14-8-7-13(9-15(14)22-16(18)23)21-17(24)20-12-5-3-11(10-19)4-6-12/h3-9H,1-2H3,(H,22,23)(H2,20,21,24) |
| InChIKey | XZBMWJCUPWNQCK-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 94.02 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.35 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |